C11H16O2 — CID 57198938
2-methylidenehex-4-enyl 2-methylprop-2-enoate (PubChem CID 57198938) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methylidenehex-4-enyl 2-methylprop-2-enoate.
| Compound Name | 2-methylidenehex-4-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57198938 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-methylidenehex-4-enyl 2-methylprop-2-enoate |
| SMILES | C=C(CC=CC)COC(=O)C(=C)C |
| InChI | InChI=1S/C11H16O2/c1-5-6-7-10(4)8-13-11(12)9(2)3/h5-6H,2,4,7-8H2,1,3H3 |
| InChIKey | XQUYCFWILJPTNU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|