C16H18F3NO5 — CID 57201917
(2,2,2-trifluoroacetyl) 4-(2,3-dimethoxyphenyl)piperidine-4-carboxylate (PubChem CID 57201917) has the molecular formula C16H18F3NO5 and a molecular weight of 361.32 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-(2,3-dimethoxyphenyl)piperidine-4-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-(2,3-dimethoxyphenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 57201917 |
| Molecular Formula | C16H18F3NO5 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-(2,3-dimethoxyphenyl)piperidine-4-carboxylate |
| SMILES | COc1cccc(C2(C(=O)OC(=O)C(F)(F)F)CCNCC2)c1OC |
| InChI | InChI=1S/C16H18F3NO5/c1-23-11-5-3-4-10(12(11)24-2)15(6-8-20-9-7-15)13(21)25-14(22)16(17,18)19/h3-5,20H,6-9H2,1-2H3 |
| InChIKey | DQGGRSFTQNSSIZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|