C8H9F4NO3 — CID 174230111
(2,2,2-trifluoroacetyl) 4-fluoropiperidine-4-carboxylate (PubChem CID 174230111) has the molecular formula C8H9F4NO3 and a molecular weight of 243.16 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-fluoropiperidine-4-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-fluoropiperidine-4-carboxylate |
|---|---|
| PubChem CID | 174230111 |
| Molecular Formula | C8H9F4NO3 |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-fluoropiperidine-4-carboxylate |
| SMILES | O=C(OC(=O)C1(F)CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C8H9F4NO3/c9-7(1-3-13-4-2-7)5(14)16-6(15)8(10,11)12/h13H,1-4H2 |
| InChIKey | WIVNEQKNAFPKMF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|