C18H16N2O6S2 — CID 57201920
(2-phenoxysulfonylphenyl) 2,4-diaminobenzenesulfonate (PubChem CID 57201920) has the molecular formula C18H16N2O6S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is (2-phenoxysulfonylphenyl) 2,4-diaminobenzenesulfonate.
| Compound Name | (2-phenoxysulfonylphenyl) 2,4-diaminobenzenesulfonate |
|---|---|
| PubChem CID | 57201920 |
| Molecular Formula | C18H16N2O6S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | (2-phenoxysulfonylphenyl) 2,4-diaminobenzenesulfonate |
| SMILES | Nc1ccc(S(=O)(=O)Oc2ccccc2S(=O)(=O)Oc2ccccc2)c(N)c1 |
| InChI | InChI=1S/C18H16N2O6S2/c19-13-10-11-17(15(20)12-13)27(21,22)26-16-8-4-5-9-18(16)28(23,24)25-14-6-2-1-3-7-14/h1-12H,19-20H2 |
| InChIKey | JIXBJNMNAXDWCC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|