C24H33N3O2 — CID 57204709
N-benzyl-N-(2,2-dimethoxyethyl)-1-methyl-4-phenylpiperidine-4-carboximidamide (PubChem CID 57204709) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-benzyl-N-(2,2-dimethoxyethyl)-1-methyl-4-phenylpiperidine-4-carboximidamide.
| Compound Name | N-benzyl-N-(2,2-dimethoxyethyl)-1-methyl-4-phenylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 57204709 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-benzyl-N-(2,2-dimethoxyethyl)-1-methyl-4-phenylpiperidine-4-carboximidamide |
| SMILES | [H]/N=C(/N(Cc1ccccc1)CC(OC)OC)C1(c2ccccc2)CCN(C)CC1 |
| InChI | InChI=1S/C24H33N3O2/c1-26-16-14-24(15-17-26,21-12-8-5-9-13-21)23(25)27(19-22(28-2)29-3)18-20-10-6-4-7-11-20/h4-13,22,25H,14-19H2,1-3H3/b25-23+ |
| InChIKey | ZXRXPUPRUHSVRX-WJTDDFOZSA-N |
| XLogP | 3.75 |
| TPSA | 48.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|