C15H20O3S — CID 57210171
2-[2-(3-hydroxy-4-thiophen-2-ylbut-1-enyl)cyclopentyl]acetic acid (PubChem CID 57210171) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[2-(3-hydroxy-4-thiophen-2-ylbut-1-enyl)cyclopentyl]acetic acid.
| Compound Name | 2-[2-(3-hydroxy-4-thiophen-2-ylbut-1-enyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 57210171 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[2-(3-hydroxy-4-thiophen-2-ylbut-1-enyl)cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1CCCC1C=CC(O)Cc1cccs1 |
| InChI | InChI=1S/C15H20O3S/c16-13(10-14-5-2-8-19-14)7-6-11-3-1-4-12(11)9-15(17)18/h2,5-8,11-13,16H,1,3-4,9-10H2,(H,17,18) |
| InChIKey | CLDAYXWYTUSPHQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|