C23H21O7S- — CID 57211519
1-(3-carboxy-4-hydroxyphenoxy)-1-(4-phenylmethoxyphenyl)propane-1-sulfinate (PubChem CID 57211519) has the molecular formula C23H21O7S- and a molecular weight of 441.48 g/mol. Its IUPAC name is 1-(3-carboxy-4-hydroxyphenoxy)-1-(4-phenylmethoxyphenyl)propane-1-sulfinate.
| Compound Name | 1-(3-carboxy-4-hydroxyphenoxy)-1-(4-phenylmethoxyphenyl)propane-1-sulfinate |
|---|---|
| PubChem CID | 57211519 |
| Molecular Formula | C23H21O7S- |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 1-(3-carboxy-4-hydroxyphenoxy)-1-(4-phenylmethoxyphenyl)propane-1-sulfinate |
| SMILES | CCC(Oc1ccc(O)c(C(=O)O)c1)(c1ccc(OCc2ccccc2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C23H22O7S/c1-2-23(31(27)28,30-19-12-13-21(24)20(14-19)22(25)26)17-8-10-18(11-9-17)29-15-16-6-4-3-5-7-16/h3-14,24H,2,15H2,1H3,(H,25,26)(H,27,28)/p-1 |
| InChIKey | NXUXKQWOTKZQKV-UHFFFAOYSA-M |
| XLogP | 4.19 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|