C17H16ClO6S- — CID 57214878
1-(3-carboxy-4-hydroxyphenoxy)-1-(4-chlorophenyl)butane-1-sulfinate (PubChem CID 57214878) has the molecular formula C17H16ClO6S- and a molecular weight of 383.83 g/mol. Its IUPAC name is 1-(3-carboxy-4-hydroxyphenoxy)-1-(4-chlorophenyl)butane-1-sulfinate.
| Compound Name | 1-(3-carboxy-4-hydroxyphenoxy)-1-(4-chlorophenyl)butane-1-sulfinate |
|---|---|
| PubChem CID | 57214878 |
| Molecular Formula | C17H16ClO6S- |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 1-(3-carboxy-4-hydroxyphenoxy)-1-(4-chlorophenyl)butane-1-sulfinate |
| SMILES | CCCC(Oc1ccc(O)c(C(=O)O)c1)(c1ccc(Cl)cc1)S(=O)[O-] |
| InChI | InChI=1S/C17H17ClO6S/c1-2-9-17(25(22)23,11-3-5-12(18)6-4-11)24-13-7-8-15(19)14(10-13)16(20)21/h3-8,10,19H,2,9H2,1H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | JNZRJVHQPOSIIF-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|