C16H15ClO6S — CID 57210492
5-[1-(4-chlorophenyl)-1-sulfinopropoxy]-2-hydroxybenzoic acid (PubChem CID 57210492) has the molecular formula C16H15ClO6S and a molecular weight of 370.81 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)-1-sulfinopropoxy]-2-hydroxybenzoic acid.
| Compound Name | 5-[1-(4-chlorophenyl)-1-sulfinopropoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 57210492 |
| Molecular Formula | C16H15ClO6S |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 5-[1-(4-chlorophenyl)-1-sulfinopropoxy]-2-hydroxybenzoic acid |
| SMILES | CCC(Oc1ccc(O)c(C(=O)O)c1)(c1ccc(Cl)cc1)S(=O)O |
| InChI | InChI=1S/C16H15ClO6S/c1-2-16(24(21)22,10-3-5-11(17)6-4-10)23-12-7-8-14(18)13(9-12)15(19)20/h3-9,18H,2H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | OYXQQFQKRFEHLU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|