C30H29NO — CID 57215443
N-methoxy-1,3-bis(4-methylphenyl)-1,3-diphenylprop-1-en-2-amine (PubChem CID 57215443) has the molecular formula C30H29NO and a molecular weight of 419.57 g/mol. Its IUPAC name is N-methoxy-1,3-bis(4-methylphenyl)-1,3-diphenylprop-1-en-2-amine.
| Compound Name | N-methoxy-1,3-bis(4-methylphenyl)-1,3-diphenylprop-1-en-2-amine |
|---|---|
| PubChem CID | 57215443 |
| Molecular Formula | C30H29NO |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-methoxy-1,3-bis(4-methylphenyl)-1,3-diphenylprop-1-en-2-amine |
| SMILES | CONC(=C(c1ccccc1)c1ccc(C)cc1)C(c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H29NO/c1-22-14-18-26(19-15-22)28(24-10-6-4-7-11-24)30(31-32-3)29(25-12-8-5-9-13-25)27-20-16-23(2)17-21-27/h4-21,28,31H,1-3H3 |
| InChIKey | MIIXYNBRVQZASO-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|