About 3-trityl-2H-oxazine
3-trityl-2H-oxazine (PubChem CID 70579892) has the molecular formula C23H19NO
and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-trityl-2H-oxazine.
Molecular Properties
| Compound Name | 3-trityl-2H-oxazine |
| PubChem CID | 70579892 |
| Molecular Formula | C23H19NO |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-trityl-2H-oxazine |
| SMILES | C1=CONC(C(c2ccccc2)(c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C23H19NO/c1-4-11-19(12-5-1)23(20-13-6-2-7-14-20,21-15-8-3-9-16-21)22-17-10-18-25-24-22/h1-18,24H |
| InChIKey | BFBFSJXGBPFFPV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 3-trityl-2H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trityl-2H-oxazine?
The IUPAC name of 3-trityl-2H-oxazine (CID 70579892) is 3-trityl-2H-oxazine.
What is the SMILES notation for 3-trityl-2H-oxazine?
The canonical SMILES for 3-trityl-2H-oxazine is C1=CONC(C(c2ccccc2)(c2ccccc2)c2ccccc2)=C1.
What is the InChIKey of 3-trityl-2H-oxazine?
The InChIKey is BFBFSJXGBPFFPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO/c1-4-11-19(12-5-1)23(20-13-6-2-7-14-20,21-15-8-3-9-16-21)22-17-10-18-25-24-22/h1-18,24H.
What are the key properties of 3-trityl-2H-oxazine?
3-trityl-2H-oxazine has a molecular weight of 325.41 g/mol, XLogP of 4.95, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trityl-2H-oxazine is sourced from PubChem (CID 70579892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).