C20H27ClN2O — CID 57217242
3-[1-(4-chlorophenyl)ethenyl]-N-[2-(dimethylamino)ethoxy]-5,5-dimethylcyclohexa-1,3-dien-1-amine (PubChem CID 57217242) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)ethenyl]-N-[2-(dimethylamino)ethoxy]-5,5-dimethylcyclohexa-1,3-dien-1-amine.
| Compound Name | 3-[1-(4-chlorophenyl)ethenyl]-N-[2-(dimethylamino)ethoxy]-5,5-dimethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 57217242 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3-[1-(4-chlorophenyl)ethenyl]-N-[2-(dimethylamino)ethoxy]-5,5-dimethylcyclohexa-1,3-dien-1-amine |
| SMILES | C=C(C1=CC(C)(C)CC(NOCCN(C)C)=C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H27ClN2O/c1-15(16-6-8-18(21)9-7-16)17-12-19(14-20(2,3)13-17)22-24-11-10-23(4)5/h6-9,12-13,22H,1,10-11,14H2,2-5H3 |
| InChIKey | VOINRETZJIAILK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|