C7H9IN2O3 — CID 57219028
N-[(2,5-dihydroxypyrrol-1-yl)methyl]-2-iodoacetamide (PubChem CID 57219028) has the molecular formula C7H9IN2O3 and a molecular weight of 296.06 g/mol. Its IUPAC name is N-[(2,5-dihydroxypyrrol-1-yl)methyl]-2-iodoacetamide.
| Compound Name | N-[(2,5-dihydroxypyrrol-1-yl)methyl]-2-iodoacetamide |
|---|---|
| PubChem CID | 57219028 |
| Molecular Formula | C7H9IN2O3 |
| Molecular Weight | 296.06 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | N-[(2,5-dihydroxypyrrol-1-yl)methyl]-2-iodoacetamide |
| SMILES | O=C(CI)NCn1c(O)ccc1O |
| InChI | InChI=1S/C7H9IN2O3/c8-3-5(11)9-4-10-6(12)1-2-7(10)13/h1-2,12-13H,3-4H2,(H,9,11) |
| InChIKey | UGMJWVGQXNNXBN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.06 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|