C13H16O2 — CID 57219180
2-penta-1,4-dien-2-yloxyethoxybenzene (PubChem CID 57219180) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-penta-1,4-dien-2-yloxyethoxybenzene.
| Compound Name | 2-penta-1,4-dien-2-yloxyethoxybenzene |
|---|---|
| PubChem CID | 57219180 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-penta-1,4-dien-2-yloxyethoxybenzene |
| SMILES | C=CCC(=C)OCCOc1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-3-7-12(2)14-10-11-15-13-8-5-4-6-9-13/h3-6,8-9H,1-2,7,10-11H2 |
| InChIKey | XRCSMCZIAMJJTB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|