C12H22N2 — CID 57220312
1-cyclohexyl-1,2-bis(prop-2-enyl)hydrazine (PubChem CID 57220312) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-cyclohexyl-1,2-bis(prop-2-enyl)hydrazine.
| Compound Name | 1-cyclohexyl-1,2-bis(prop-2-enyl)hydrazine |
|---|---|
| PubChem CID | 57220312 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-cyclohexyl-1,2-bis(prop-2-enyl)hydrazine |
| SMILES | C=CCNN(CC=C)C1CCCCC1 |
| InChI | InChI=1S/C12H22N2/c1-3-10-13-14(11-4-2)12-8-6-5-7-9-12/h3-4,12-13H,1-2,5-11H2 |
| InChIKey | ABPZXSUHEGQPCZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|