C11H11F9O2 — CID 57220994
4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylic acid (PubChem CID 57220994) has the molecular formula C11H11F9O2 and a molecular weight of 346.19 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57220994 |
| Molecular Formula | C11H11F9O2 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H11F9O2/c12-8(13,6-3-1-5(2-4-6)7(21)22)9(14,15)10(16,17)11(18,19)20/h5-6H,1-4H2,(H,21,22) |
| InChIKey | IVISRMWAKRCKHH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|