C35H40N4O — CID 57223620
N-[1-[4-[9-(4-ethyl-5-methyl-1H-imidazol-2-yl)fluoren-9-yl]butyl]piperidin-4-yl]benzamide (PubChem CID 57223620) has the molecular formula C35H40N4O and a molecular weight of 532.73 g/mol. Its IUPAC name is N-[1-[4-[9-(4-ethyl-5-methyl-1H-imidazol-2-yl)fluoren-9-yl]butyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[4-[9-(4-ethyl-5-methyl-1H-imidazol-2-yl)fluoren-9-yl]butyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 57223620 |
| Molecular Formula | C35H40N4O |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | N-[1-[4-[9-(4-ethyl-5-methyl-1H-imidazol-2-yl)fluoren-9-yl]butyl]piperidin-4-yl]benzamide |
| SMILES | CCc1nc(C2(CCCCN3CCC(NC(=O)c4ccccc4)CC3)c3ccccc3-c3ccccc32)[nH]c1C |
| InChI | InChI=1S/C35H40N4O/c1-3-32-25(2)36-34(38-32)35(30-17-9-7-15-28(30)29-16-8-10-18-31(29)35)21-11-12-22-39-23-19-27(20-24-39)37-33(40)26-13-5-4-6-14-26/h4-10,13-18,27H,3,11-12,19-24H2,1-2H3,(H,36,38)(H,37,40) |
| InChIKey | RSBKXCZSDPQYLH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|