C20H32N2O — CID 57224733
N-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-2-methylbenzamide (PubChem CID 57224733) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is N-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-2-methylbenzamide.
| Compound Name | N-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 57224733 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | N-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-2-methylbenzamide |
| SMILES | CCC1(C)CC(NC(=O)c2ccccc2C)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C20H32N2O/c1-7-19(5)13-17(15(4)20(6,8-2)22-19)21-18(23)16-12-10-9-11-14(16)3/h9-12,15,17,22H,7-8,13H2,1-6H3,(H,21,23) |
| InChIKey | DUJHJYIADAOENO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |