C17H28O2 — CID 57228184
8'-(2-methylpropyl)-6'-propan-2-ylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] (PubChem CID 57228184) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 8'-(2-methylpropyl)-6'-propan-2-ylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene].
| Compound Name | 8'-(2-methylpropyl)-6'-propan-2-ylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
|---|---|
| PubChem CID | 57228184 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 8'-(2-methylpropyl)-6'-propan-2-ylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]oct-2-ene] |
| SMILES | CC(C)CC1C2C=CCCC2(C(C)C)C12OCCO2 |
| InChI | InChI=1S/C17H28O2/c1-12(2)11-15-14-7-5-6-8-16(14,13(3)4)17(15)18-9-10-19-17/h5,7,12-15H,6,8-11H2,1-4H3 |
| InChIKey | CDSPTZHDGUYRFP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|