C15H19N3O — CID 57229001
4-[(7S,8aS)-7-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]benzonitrile (PubChem CID 57229001) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-[(7S,8aS)-7-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]benzonitrile.
| Compound Name | 4-[(7S,8aS)-7-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 57229001 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 4-[(7S,8aS)-7-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN3C[C@@H](CO)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C15H19N3O/c16-8-12-1-3-14(4-2-12)18-6-5-17-9-13(11-19)7-15(17)10-18/h1-4,13,15,19H,5-7,9-11H2/t13-,15-/m0/s1 |
| InChIKey | XENSJWUCTNSEHH-ZFWWWQNUSA-N |
| XLogP | 1.06 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |