C24H26F2N6O4S — CID 57232860
(2S,3R)-2-(2,4-difluorophenyl)-3-[4-[2-(ethoxymethyl)-5-methylsulfonyl-1,2,4-triazol-3-yl]phenyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 57232860) has the molecular formula C24H26F2N6O4S and a molecular weight of 532.57 g/mol. Its IUPAC name is (2S,3R)-2-(2,4-difluorophenyl)-3-[4-[2-(ethoxymethyl)-5-methylsulfonyl-1,2,4-triazol-3-yl]phenyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2S,3R)-2-(2,4-difluorophenyl)-3-[4-[2-(ethoxymethyl)-5-methylsulfonyl-1,2,4-triazol-3-yl]phenyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 57232860 |
| Molecular Formula | C24H26F2N6O4S |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | (2S,3R)-2-(2,4-difluorophenyl)-3-[4-[2-(ethoxymethyl)-5-methylsulfonyl-1,2,4-triazol-3-yl]phenyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CCOCn1nc(S(C)(=O)=O)nc1-c1ccc([C@@H](C)[C@@](O)(Cn2cncn2)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C24H26F2N6O4S/c1-4-36-15-32-22(29-23(30-32)37(3,34)35)18-7-5-17(6-8-18)16(2)24(33,12-31-14-27-13-28-31)20-10-9-19(25)11-21(20)26/h5-11,13-14,16,33H,4,12,15H2,1-3H3/t16-,24+/m1/s1 |
| InChIKey | CGMVOJUMOXSEFT-GYCJOSAFSA-N |
| XLogP | 2.90 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |