C22H20O5S — CID 57234801
methyl [3-oxo-4-(oxolan-2-yl)-2,5-diphenylthiophen-2-yl] carbonate (PubChem CID 57234801) has the molecular formula C22H20O5S and a molecular weight of 396.46 g/mol. Its IUPAC name is methyl [3-oxo-4-(oxolan-2-yl)-2,5-diphenylthiophen-2-yl] carbonate.
| Compound Name | methyl [3-oxo-4-(oxolan-2-yl)-2,5-diphenylthiophen-2-yl] carbonate |
|---|---|
| PubChem CID | 57234801 |
| Molecular Formula | C22H20O5S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | methyl [3-oxo-4-(oxolan-2-yl)-2,5-diphenylthiophen-2-yl] carbonate |
| SMILES | COC(=O)OC1(c2ccccc2)SC(c2ccccc2)=C(C2CCCO2)C1=O |
| InChI | InChI=1S/C22H20O5S/c1-25-21(24)27-22(16-11-6-3-7-12-16)20(23)18(17-13-8-14-26-17)19(28-22)15-9-4-2-5-10-15/h2-7,9-12,17H,8,13-14H2,1H3 |
| InChIKey | QVLCVYGOUIBVEY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |