C7H11NO2 — CID 57240918
2-(3,6-dihydro-2H-pyridin-1-yl)acetic acid (PubChem CID 57240918) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyridin-1-yl)acetic acid.
| Compound Name | 2-(3,6-dihydro-2H-pyridin-1-yl)acetic acid |
|---|---|
| PubChem CID | 57240918 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyridin-1-yl)acetic acid |
| SMILES | O=C(O)CN1CC=CCC1 |
| InChI | InChI=1S/C7H11NO2/c9-7(10)6-8-4-2-1-3-5-8/h1-2H,3-6H2,(H,9,10) |
| InChIKey | DVBSECCFBPJRQL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|