C12H13Cl2NO5S — CID 57242448
ethylsulfonyl (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoate (PubChem CID 57242448) has the molecular formula C12H13Cl2NO5S and a molecular weight of 354.21 g/mol. Its IUPAC name is ethylsulfonyl (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoate.
| Compound Name | ethylsulfonyl (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 57242448 |
| Molecular Formula | C12H13Cl2NO5S |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | ethylsulfonyl (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoate |
| SMILES | CCS(=O)(=O)OC(=O)[C@H](N)CC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO5S/c1-2-21(18,19)20-12(17)10(15)6-11(16)7-3-4-8(13)9(14)5-7/h3-5,10H,2,6,15H2,1H3/t10-/m1/s1 |
| InChIKey | BGRSJKZKDHHORI-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|