C18H16FNO5 — CID 57242789
3-[4-[2-amino-3-(3-fluorophenyl)propanoyl]oxyphenyl]-2-oxopropanoic acid (PubChem CID 57242789) has the molecular formula C18H16FNO5 and a molecular weight of 345.33 g/mol. Its IUPAC name is 3-[4-[2-amino-3-(3-fluorophenyl)propanoyl]oxyphenyl]-2-oxopropanoic acid.
| Compound Name | 3-[4-[2-amino-3-(3-fluorophenyl)propanoyl]oxyphenyl]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 57242789 |
| Molecular Formula | C18H16FNO5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-[4-[2-amino-3-(3-fluorophenyl)propanoyl]oxyphenyl]-2-oxopropanoic acid |
| SMILES | NC(Cc1cccc(F)c1)C(=O)Oc1ccc(CC(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H16FNO5/c19-13-3-1-2-12(8-13)9-15(20)18(24)25-14-6-4-11(5-7-14)10-16(21)17(22)23/h1-8,15H,9-10,20H2,(H,22,23) |
| InChIKey | RZTSXLHPNMEKNI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|