C15H17ClN4O2 — CID 57245068
3-(6-chloro-3-pyridinyl)-1-(2-ethylpyrrol-2-yl)-N-methyl-1-nitropropan-2-imine (PubChem CID 57245068) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-1-(2-ethylpyrrol-2-yl)-N-methyl-1-nitropropan-2-imine.
| Compound Name | 3-(6-chloro-3-pyridinyl)-1-(2-ethylpyrrol-2-yl)-N-methyl-1-nitropropan-2-imine |
|---|---|
| PubChem CID | 57245068 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-1-(2-ethylpyrrol-2-yl)-N-methyl-1-nitropropan-2-imine |
| SMILES | CCC1(C(/C(Cc2ccc(Cl)nc2)=N/C)[N+](=O)[O-])C=CC=N1 |
| InChI | InChI=1S/C15H17ClN4O2/c1-3-15(7-4-8-19-15)14(20(21)22)12(17-2)9-11-5-6-13(16)18-10-11/h4-8,10,14H,3,9H2,1-2H3/b17-12+ |
| InChIKey | MKONUDCYOGOCND-SFQUDFHCSA-N |
| XLogP | 2.78 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|