C24H32N4O4 — CID 57249762
4-[2-[[(2R)-2-[[(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoyl]amino]propanoyl]amino]phenyl]-N-methylbutanamide (PubChem CID 57249762) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-[2-[[(2R)-2-[[(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoyl]amino]propanoyl]amino]phenyl]-N-methylbutanamide.
| Compound Name | 4-[2-[[(2R)-2-[[(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoyl]amino]propanoyl]amino]phenyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 57249762 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 4-[2-[[(2R)-2-[[(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoyl]amino]propanoyl]amino]phenyl]-N-methylbutanamide |
| SMILES | CNC(=O)CCCc1ccccc1NC(=O)[C@@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC |
| InChI | InChI=1S/C24H32N4O4/c1-16(27-24(32)21(25-2)15-17-11-13-19(29)14-12-17)23(31)28-20-9-5-4-7-18(20)8-6-10-22(30)26-3/h4-5,7,9,11-14,16,21,25,29H,6,8,10,15H2,1-3H3,(H,26,30)(H,27,32)(H,28,31)/t16-,21+/m1/s1 |
| InChIKey | MAZRXTOFZQSVLS-IERDGZPVSA-N |
| XLogP | 1.73 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |