C30H39N4O8P — CID 70443321
4-[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]phenyl]-N-(2-phenylethyl)butanamide;phosphoric acid (PubChem CID 70443321) has the molecular formula C30H39N4O8P and a molecular weight of 614.64 g/mol. Its IUPAC name is 4-[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]phenyl]-N-(2-phenylethyl)butanamide;phosphoric acid.
| Compound Name | 4-[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]phenyl]-N-(2-phenylethyl)butanamide;phosphoric acid |
|---|---|
| PubChem CID | 70443321 |
| Molecular Formula | C30H39N4O8P |
| Molecular Weight | 614.64 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 4-[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]phenyl]-N-(2-phenylethyl)butanamide;phosphoric acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)Nc1ccccc1CCCC(=O)NCCc1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C30H36N4O4.H3O4P/c1-21(33-30(38)26(31)20-23-14-16-25(35)17-15-23)29(37)34-27-12-6-5-10-24(27)11-7-13-28(36)32-19-18-22-8-3-2-4-9-22;1-5(2,3)4/h2-6,8-10,12,14-17,21,26,35H,7,11,13,18-20,31H2,1H3,(H,32,36)(H,33,38)(H,34,37);(H3,1,2,3,4)/t21-,26-;/m0./s1 |
| InChIKey | BEURMXLKMZMPMO-SCFGKSIXSA-N |
| XLogP | 2.16 |
| TPSA | 211.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|