C23H33ClN4O5 — CID 70444577
4-[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]phenyl]-N-methylbutanamide;hydrate;hydrochloride (PubChem CID 70444577) has the molecular formula C23H33ClN4O5 and a molecular weight of 480.99 g/mol. Its IUPAC name is 4-[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]phenyl]-N-methylbutanamide;hydrate;hydrochloride.
| Compound Name | 4-[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]phenyl]-N-methylbutanamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 70444577 |
| Molecular Formula | C23H33ClN4O5 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 4-[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]phenyl]-N-methylbutanamide;hydrate;hydrochloride |
| SMILES | CNC(=O)CCCc1ccccc1NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1.Cl.O |
| InChI | InChI=1S/C23H30N4O4.ClH.H2O/c1-15(26-23(31)19(24)14-16-10-12-18(28)13-11-16)22(30)27-20-8-4-3-6-17(20)7-5-9-21(29)25-2;;/h3-4,6,8,10-13,15,19,28H,5,7,9,14,24H2,1-2H3,(H,25,29)(H,26,31)(H,27,30);1H;1H2/t15-,19-;;/m0../s1 |
| InChIKey | FFLDFXZNEIXQDK-OIEUEQSUSA-N |
| XLogP | 1.07 |
| TPSA | 165.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |