C21H34N2O3Si — CID 57253205
2-phenyl-N-[2-[5-(4-trimethoxysilylbutyl)-1H-pyrrol-3-yl]ethyl]ethanamine (PubChem CID 57253205) has the molecular formula C21H34N2O3Si and a molecular weight of 390.60 g/mol. Its IUPAC name is 2-phenyl-N-[2-[5-(4-trimethoxysilylbutyl)-1H-pyrrol-3-yl]ethyl]ethanamine.
| Compound Name | 2-phenyl-N-[2-[5-(4-trimethoxysilylbutyl)-1H-pyrrol-3-yl]ethyl]ethanamine |
|---|---|
| PubChem CID | 57253205 |
| Molecular Formula | C21H34N2O3Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 2-phenyl-N-[2-[5-(4-trimethoxysilylbutyl)-1H-pyrrol-3-yl]ethyl]ethanamine |
| SMILES | CO[Si](CCCCc1cc(CCNCCc2ccccc2)c[nH]1)(OC)OC |
| InChI | InChI=1S/C21H34N2O3Si/c1-24-27(25-2,26-3)16-8-7-11-21-17-20(18-23-21)13-15-22-14-12-19-9-5-4-6-10-19/h4-6,9-10,17-18,22-23H,7-8,11-16H2,1-3H3 |
| InChIKey | USZLCZDHHDCGFI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|