C18H24O4 — CID 57257405
7-[2-oxo-5-(3-oxohex-1-enyl)cyclopentyl]hept-5-ynoic acid (PubChem CID 57257405) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 7-[2-oxo-5-(3-oxohex-1-enyl)cyclopentyl]hept-5-ynoic acid.
| Compound Name | 7-[2-oxo-5-(3-oxohex-1-enyl)cyclopentyl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 57257405 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 7-[2-oxo-5-(3-oxohex-1-enyl)cyclopentyl]hept-5-ynoic acid |
| SMILES | CCCC(=O)C=CC1CCC(=O)C1CC#CCCCC(=O)O |
| InChI | InChI=1S/C18H24O4/c1-2-7-15(19)12-10-14-11-13-17(20)16(14)8-5-3-4-6-9-18(21)22/h10,12,14,16H,2,4,6-9,11,13H2,1H3,(H,21,22) |
| InChIKey | UTDUQNNUQGPNRG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|