C10H10N2O3 — CID 57258718
7-acetyl-4-methylpyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 57258718) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 7-acetyl-4-methylpyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 7-acetyl-4-methylpyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 57258718 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 7-acetyl-4-methylpyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC(=O)c1cnc2c(c1)OCC(=O)N2C |
| InChI | InChI=1S/C10H10N2O3/c1-6(13)7-3-8-10(11-4-7)12(2)9(14)5-15-8/h3-4H,5H2,1-2H3 |
| InChIKey | PVOMHRKYOACHMU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |