C12H22OSi — CID 57260359
trimethyl(6-methyloct-1-en-7-yn-4-yloxy)silane (PubChem CID 57260359) has the molecular formula C12H22OSi and a molecular weight of 210.39 g/mol. Its IUPAC name is trimethyl(6-methyloct-1-en-7-yn-4-yloxy)silane.
| Compound Name | trimethyl(6-methyloct-1-en-7-yn-4-yloxy)silane |
|---|---|
| PubChem CID | 57260359 |
| Molecular Formula | C12H22OSi |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | trimethyl(6-methyloct-1-en-7-yn-4-yloxy)silane |
| SMILES | C#CC(C)CC(CC=C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H22OSi/c1-7-9-12(10-11(3)8-2)13-14(4,5)6/h2,7,11-12H,1,9-10H2,3-6H3 |
| InChIKey | RDQZQJMZPVJHKL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|