C14H26O5 — CID 57261543
[3-hydroxy-2,2-bis(1-hydroxyethyl)butyl] 2,3-dimethylbut-2-enoate (PubChem CID 57261543) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(1-hydroxyethyl)butyl] 2,3-dimethylbut-2-enoate.
| Compound Name | [3-hydroxy-2,2-bis(1-hydroxyethyl)butyl] 2,3-dimethylbut-2-enoate |
|---|---|
| PubChem CID | 57261543 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | [3-hydroxy-2,2-bis(1-hydroxyethyl)butyl] 2,3-dimethylbut-2-enoate |
| SMILES | CC(C)=C(C)C(=O)OCC(C(C)O)(C(C)O)C(C)O |
| InChI | InChI=1S/C14H26O5/c1-8(2)9(3)13(18)19-7-14(10(4)15,11(5)16)12(6)17/h10-12,15-17H,7H2,1-6H3 |
| InChIKey | OTZAMMJWYUOMFJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|