C5H12NO7P — CID 57263867
[[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]phosphonic acid (PubChem CID 57263867) has the molecular formula C5H12NO7P and a molecular weight of 229.12 g/mol. Its IUPAC name is [[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]phosphonic acid.
| Compound Name | [[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]phosphonic acid |
|---|---|
| PubChem CID | 57263867 |
| Molecular Formula | C5H12NO7P |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | [[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]amino]phosphonic acid |
| SMILES | O=P(O)(O)NC1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H12NO7P/c7-1-2-3(8)4(9)5(13-2)6-14(10,11)12/h2-5,7-9H,1H2,(H3,6,10,11,12)/t2-,3-,4-,5?/m1/s1 |
| InChIKey | JHENRZZWKKWSRZ-SOOFDHNKSA-N |
| XLogP | -2.89 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|