C12H18 — CID 57264350
(4E)-3,3,4,5-tetramethylocta-1,4-dien-7-yne (PubChem CID 57264350) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (4E)-3,3,4,5-tetramethylocta-1,4-dien-7-yne.
| Compound Name | (4E)-3,3,4,5-tetramethylocta-1,4-dien-7-yne |
|---|---|
| PubChem CID | 57264350 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (4E)-3,3,4,5-tetramethylocta-1,4-dien-7-yne |
| SMILES | C#CC/C(C)=C(\C)C(C)(C)C=C |
| InChI | InChI=1S/C12H18/c1-7-9-10(3)11(4)12(5,6)8-2/h1,8H,2,9H2,3-6H3/b11-10+ |
| InChIKey | GBJNQFPLOJWFKN-ZHACJKMWSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|