C21H18ClN3O2S — CID 57265507
2-[2-[2-(3-chlorophenyl)sulfanylethoxy]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 57265507) has the molecular formula C21H18ClN3O2S and a molecular weight of 411.91 g/mol. Its IUPAC name is 2-[2-[2-(3-chlorophenyl)sulfanylethoxy]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[2-[2-(3-chlorophenyl)sulfanylethoxy]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 57265507 |
| Molecular Formula | C21H18ClN3O2S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-[2-[2-(3-chlorophenyl)sulfanylethoxy]-4-methoxyphenyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1ccc(-c2nc3ncccc3[nH]2)c(OCCSc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C21H18ClN3O2S/c1-26-15-7-8-17(20-24-18-6-3-9-23-21(18)25-20)19(13-15)27-10-11-28-16-5-2-4-14(22)12-16/h2-9,12-13H,10-11H2,1H3,(H,23,24,25) |
| InChIKey | WVUXHTFWEXPWIO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|