C16H16N4O3S — CID 88664724
[2-(1H-imidazo[4,5-b]pyridin-2-yl)-5-methoxyphenyl] N-sulfanyloxypropanimidate (PubChem CID 88664724) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is [2-(1H-imidazo[4,5-b]pyridin-2-yl)-5-methoxyphenyl] N-sulfanyloxypropanimidate.
| Compound Name | [2-(1H-imidazo[4,5-b]pyridin-2-yl)-5-methoxyphenyl] N-sulfanyloxypropanimidate |
|---|---|
| PubChem CID | 88664724 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [2-(1H-imidazo[4,5-b]pyridin-2-yl)-5-methoxyphenyl] N-sulfanyloxypropanimidate |
| SMILES | CCC(=NOS)Oc1cc(OC)ccc1-c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C16H16N4O3S/c1-3-14(20-23-24)22-13-9-10(21-2)6-7-11(13)15-18-12-5-4-8-17-16(12)19-15/h4-9,24H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | QUMXGNQNHQTECI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|