C17H15ClO — CID 57270189
1-[chloro-(4-methoxyphenyl)methyl]-3-propa-1,2-dienylbenzene (PubChem CID 57270189) has the molecular formula C17H15ClO and a molecular weight of 270.76 g/mol. Its IUPAC name is 1-[chloro-(4-methoxyphenyl)methyl]-3-propa-1,2-dienylbenzene.
| Compound Name | 1-[chloro-(4-methoxyphenyl)methyl]-3-propa-1,2-dienylbenzene |
|---|---|
| PubChem CID | 57270189 |
| Molecular Formula | C17H15ClO |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-[chloro-(4-methoxyphenyl)methyl]-3-propa-1,2-dienylbenzene |
| SMILES | C=C=Cc1cccc(C(Cl)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C17H15ClO/c1-3-5-13-6-4-7-15(12-13)17(18)14-8-10-16(19-2)11-9-14/h4-12,17H,1H2,2H3 |
| InChIKey | RANRNPOOBZHYQG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|