C19H37N2O+ — CID 57271596
2-[1-(2-butyldec-1-enyl)-4,5-dihydroimidazol-1-ium-1-yl]ethanol (PubChem CID 57271596) has the molecular formula C19H37N2O+ and a molecular weight of 309.52 g/mol. Its IUPAC name is 2-[1-(2-butyldec-1-enyl)-4,5-dihydroimidazol-1-ium-1-yl]ethanol.
| Compound Name | 2-[1-(2-butyldec-1-enyl)-4,5-dihydroimidazol-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 57271596 |
| Molecular Formula | C19H37N2O+ |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.29 |
| IUPAC Name | 2-[1-(2-butyldec-1-enyl)-4,5-dihydroimidazol-1-ium-1-yl]ethanol |
| SMILES | CCCCCCCCC(=C[N+]1(CCO)C=NCC1)CCCC |
| InChI | InChI=1S/C19H37N2O/c1-3-5-7-8-9-10-12-19(11-6-4-2)17-21(15-16-22)14-13-20-18-21/h17-18,22H,3-16H2,1-2H3/q+1 |
| InChIKey | CXJBZFCXJSKQDU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|