C16H33N2O+ — CID 57265843
2-(1-undecyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol (PubChem CID 57265843) has the molecular formula C16H33N2O+ and a molecular weight of 269.45 g/mol. Its IUPAC name is 2-(1-undecyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol.
| Compound Name | 2-(1-undecyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol |
|---|---|
| PubChem CID | 57265843 |
| Molecular Formula | C16H33N2O+ |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.26 |
| IUPAC Name | 2-(1-undecyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol |
| SMILES | CCCCCCCCCCC[N+]1(CCO)C=NCC1 |
| InChI | InChI=1S/C16H33N2O/c1-2-3-4-5-6-7-8-9-10-12-18(14-15-19)13-11-17-16-18/h16,19H,2-15H2,1H3/q+1 |
| InChIKey | XXQCYWFEQYXWEL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|