C8H14N2O2 — CID 172767554
2-(1-propyl-4,5-dihydroimidazol-1-ium-1-yl)acetate (PubChem CID 172767554) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-(1-propyl-4,5-dihydroimidazol-1-ium-1-yl)acetate.
| Compound Name | 2-(1-propyl-4,5-dihydroimidazol-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 172767554 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-(1-propyl-4,5-dihydroimidazol-1-ium-1-yl)acetate |
| SMILES | CCC[N+]1(CC(=O)[O-])C=NCC1 |
| InChI | InChI=1S/C8H14N2O2/c1-2-4-10(6-8(11)12)5-3-9-7-10/h7H,2-6H2,1H3 |
| InChIKey | MNDPYIRCIXDDLE-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|