C21H43N2O+ — CID 70259579
2-(1-hexadecyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol (PubChem CID 70259579) has the molecular formula C21H43N2O+ and a molecular weight of 339.59 g/mol. Its IUPAC name is 2-(1-hexadecyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol.
| Compound Name | 2-(1-hexadecyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol |
|---|---|
| PubChem CID | 70259579 |
| Molecular Formula | C21H43N2O+ |
| Molecular Weight | 339.59 g/mol |
| Exact Mass | 339.34 |
| IUPAC Name | 2-(1-hexadecyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol |
| SMILES | CCCCCCCCCCCCCCCC[N+]1(CCO)C=NCC1 |
| InChI | InChI=1S/C21H43N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-23(19-20-24)18-16-22-21-23/h21,24H,2-20H2,1H3/q+1 |
| InChIKey | UXCYLIIAXZVPDJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|