C21H41N2+ — CID 22365597
1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium (PubChem CID 22365597) has the molecular formula C21H41N2+ and a molecular weight of 321.57 g/mol. Its IUPAC name is 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium.
| Compound Name | 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 22365597 |
| Molecular Formula | C21H41N2+ |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.33 |
| IUPAC Name | 1-ethenyl-1-hexadecyl-4,5-dihydroimidazol-1-ium |
| SMILES | C=C[N+]1(CCCCCCCCCCCCCCCC)C=NCC1 |
| InChI | InChI=1S/C21H41N2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-23(4-2)20-18-22-21-23/h4,21H,2-3,5-20H2,1H3/q+1 |
| InChIKey | PERKQFZEMAEVOI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|