C27H27ClN2O2 — CID 57278440
4-(4-chlorophenyl)-1-[(5,5-diphenyl-2H-1,2-oxazol-3-yl)methyl]piperidin-4-ol (PubChem CID 57278440) has the molecular formula C27H27ClN2O2 and a molecular weight of 446.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[(5,5-diphenyl-2H-1,2-oxazol-3-yl)methyl]piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-[(5,5-diphenyl-2H-1,2-oxazol-3-yl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 57278440 |
| Molecular Formula | C27H27ClN2O2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[(5,5-diphenyl-2H-1,2-oxazol-3-yl)methyl]piperidin-4-ol |
| SMILES | OC1(c2ccc(Cl)cc2)CCN(CC2=CC(c3ccccc3)(c3ccccc3)ON2)CC1 |
| InChI | InChI=1S/C27H27ClN2O2/c28-24-13-11-21(12-14-24)26(31)15-17-30(18-16-26)20-25-19-27(32-29-25,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,19,29,31H,15-18,20H2 |
| InChIKey | VNGJCKHEXBWIHV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |