C10H13NO6 — CID 57280357
(1S,2R,3S,5R,6S)-2-acetamido-3-deuterio-3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 57280357) has the molecular formula C10H13NO6 and a molecular weight of 244.22 g/mol. Its IUPAC name is (1S,2R,3S,5R,6S)-2-acetamido-3-deuterio-3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1S,2R,3S,5R,6S)-2-acetamido-3-deuterio-3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 57280357 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (1S,2R,3S,5R,6S)-2-acetamido-3-deuterio-3-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | [2H][C@]1(O)C[C@H]2[C@H](C(=O)O)[C@H]2[C@]1(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H13NO6/c1-3(12)11-10(9(16)17)5(13)2-4-6(7(4)10)8(14)15/h4-7,13H,2H2,1H3,(H,11,12)(H,14,15)(H,16,17)/t4-,5-,6-,7-,10-/m0/s1/i5D |
| InChIKey | QAMRXJFPYSJIOA-DCWUZESDSA-N |
| XLogP | -1.34 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |