C26H32ClN3O2 — CID 57281138
(2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-2-ol (PubChem CID 57281138) has the molecular formula C26H32ClN3O2 and a molecular weight of 454.01 g/mol. Its IUPAC name is (2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 57281138 |
| Molecular Formula | C26H32ClN3O2 |
| Molecular Weight | 454.01 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (2S)-1-[(6-benzylidenecyclohexen-1-yl)amino]oxy-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-2-ol |
| SMILES | O[C@H](CONC1=CCCCC1=Cc1ccccc1)CN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C26H32ClN3O2/c27-23-10-6-11-24(18-23)30-15-13-29(14-16-30)19-25(31)20-32-28-26-12-5-4-9-22(26)17-21-7-2-1-3-8-21/h1-3,6-8,10-12,17-18,25,28,31H,4-5,9,13-16,19-20H2/t25-/m0/s1 |
| InChIKey | NCWRCBXQUSKDNP-VWLOTQADSA-N |
| XLogP | 4.50 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.01 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|