C16H22N2O2 — CID 57308154
1-amino-3-[(6-benzylidenecyclohexen-1-yl)amino]oxypropan-2-ol (PubChem CID 57308154) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-amino-3-[(6-benzylidenecyclohexen-1-yl)amino]oxypropan-2-ol.
| Compound Name | 1-amino-3-[(6-benzylidenecyclohexen-1-yl)amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 57308154 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-amino-3-[(6-benzylidenecyclohexen-1-yl)amino]oxypropan-2-ol |
| SMILES | NCC(O)CONC1=CCCCC1=Cc1ccccc1 |
| InChI | InChI=1S/C16H22N2O2/c17-11-15(19)12-20-18-16-9-5-4-8-14(16)10-13-6-2-1-3-7-13/h1-3,6-7,9-10,15,18-19H,4-5,8,11-12,17H2 |
| InChIKey | HTWZMRXUXZLANU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|