C23H27N5O4 — CID 57285092
1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-7-nitrobenzimidazole (PubChem CID 57285092) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-7-nitrobenzimidazole.
| Compound Name | 1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-7-nitrobenzimidazole |
|---|---|
| PubChem CID | 57285092 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-7-nitrobenzimidazole |
| SMILES | O=[N+]([O-])c1cccc2ncn(CCCCN3CCN(c4ccc5c(c4)OCCO5)CC3)c12 |
| InChI | InChI=1S/C23H27N5O4/c29-28(30)20-5-3-4-19-23(20)27(17-24-19)9-2-1-8-25-10-12-26(13-11-25)18-6-7-21-22(16-18)32-15-14-31-21/h3-7,16-17H,1-2,8-15H2 |
| InChIKey | QQYYVCQFZUNEMA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|