C7H13NO2S — CID 57285215
(2R)-2-methyl-4-methylsulfanylpyrrolidine-1-carboxylic acid (PubChem CID 57285215) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is (2R)-2-methyl-4-methylsulfanylpyrrolidine-1-carboxylic acid.
| Compound Name | (2R)-2-methyl-4-methylsulfanylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 57285215 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (2R)-2-methyl-4-methylsulfanylpyrrolidine-1-carboxylic acid |
| SMILES | CSC1C[C@@H](C)N(C(=O)O)C1 |
| InChI | InChI=1S/C7H13NO2S/c1-5-3-6(11-2)4-8(5)7(9)10/h5-6H,3-4H2,1-2H3,(H,9,10)/t5-,6?/m1/s1 |
| InChIKey | QSJOIGZEEHHMQN-LWOQYNTDSA-N |
| XLogP | 1.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |